C19H29N6NaO9 — CID 171550241
sodium 2-[[6-amino-2-[[4-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 171550241) has the molecular formula C19H29N6NaO9 and a molecular weight of 508.46 g/mol. Its IUPAC name is sodium 2-[[6-amino-2-[[4-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | sodium 2-[[6-amino-2-[[4-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 171550241 |
| Molecular Formula | C19H29N6NaO9 |
| Molecular Weight | 508.46 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | sodium 2-[[6-amino-2-[[4-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CCC(NC(=O)C(CCC(=O)CN)NC(=O)CCC(NC(=O)CN)C(=O)O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H30N6O9.Na/c20-7-10(26)1-3-12(17(30)25-14(19(33)34)4-2-11(27)8-21)23-15(28)6-5-13(18(31)32)24-16(29)9-22;/h8,12-14,21H,1-7,9,20,22H2,(H,23,28)(H,24,29)(H,25,30)(H,31,32)(H,33,34);/q;+1/p-1/b21-8+; |
| InChIKey | XMLMWGQAECTLAU-LQGGPMKRSA-M |
| XLogP | -7.67 |
| TPSA | 274.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.46 |
| LogP ≤ 5 | -7.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|