C26H46N6O9 — CID 171550340
formamide;N-methylmethanamine;prop-2-enyl 2-[[6-amino-2-[(5-ethoxy-4-methyl-5-oxopentanoyl)amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 171550340) has the molecular formula C26H46N6O9 and a molecular weight of 586.69 g/mol. Its IUPAC name is formamide;N-methylmethanamine;prop-2-enyl 2-[[6-amino-2-[(5-ethoxy-4-methyl-5-oxopentanoyl)amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | formamide;N-methylmethanamine;prop-2-enyl 2-[[6-amino-2-[(5-ethoxy-4-methyl-5-oxopentanoyl)amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 171550340 |
| Molecular Formula | C26H46N6O9 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | formamide;N-methylmethanamine;prop-2-enyl 2-[[6-amino-2-[(5-ethoxy-4-methyl-5-oxopentanoyl)amino]-5-oxohexanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | CNC.NC=O.[H]/N=C/C(=O)CCC(NC(=O)C(CCC(=O)CN)NC(=O)CCC(C)C(=O)OCC)C(=O)OCC=C |
| InChI | InChI=1S/C23H36N4O8.C2H7N.CH3NO/c1-4-12-35-23(33)19(10-8-17(29)14-25)27-21(31)18(9-7-16(28)13-24)26-20(30)11-6-15(3)22(32)34-5-2;1-3-2;2-1-3/h4,14-15,18-19,25H,1,5-13,24H2,2-3H3,(H,26,30)(H,27,31);3H,1-2H3;1H,(H2,2,3)/b25-14+;; |
| InChIKey | ACTZTCLOSDZHPC-OGTSOACOSA-N |
| XLogP | -1.09 |
| TPSA | 249.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|