C22H29N7O2 — CID 171550970
ethane-1,2-diol;methylcyclobutane;4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171550970) has the molecular formula C22H29N7O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is ethane-1,2-diol;methylcyclobutane;4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | ethane-1,2-diol;methylcyclobutane;4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171550970 |
| Molecular Formula | C22H29N7O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | ethane-1,2-diol;methylcyclobutane;4-N-methyl-5-(1,5-naphthyridin-2-yl)pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CC1CCC1.CNc1nc(N)nn2ccc(-c3ccc4ncccc4n3)c12.OCCO |
| InChI | InChI=1S/C15H13N7.C5H10.C2H6O2/c1-17-14-13-9(6-8-22(13)21-15(16)20-14)10-4-5-11-12(19-10)3-2-7-18-11;1-5-3-2-4-5;3-1-2-4/h2-8H,1H3,(H3,16,17,20,21);5H,2-4H2,1H3;3-4H,1-2H2 |
| InChIKey | CKXDWBBSNJDNES-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |