C18H24ClF3N4O4 — CID 171556710
N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-4-chlorobutanamide (PubChem CID 171556710) has the molecular formula C18H24ClF3N4O4 and a molecular weight of 452.86 g/mol. Its IUPAC name is N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-4-chlorobutanamide.
| Compound Name | N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 171556710 |
| Molecular Formula | C18H24ClF3N4O4 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl]-4-chlorobutanamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2CNC(=O)CCCCl |
| InChI | InChI=1S/C18H24ClF3N4O4/c1-17(2)29-15-10(25-13-8-23-7-12(26-13)18(20,21)22)9-28-11(16(15)30-17)6-24-14(27)4-3-5-19/h7-8,10-11,15-16H,3-6,9H2,1-2H3,(H,24,27)(H,25,26)/t10-,11+,15+,16-/m0/s1 |
| InChIKey | YBEIGLWKSKGBEF-TZCMFKBTSA-N |
| XLogP | 2.33 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|