C11H17F3N4O3 — CID 171556765
2-(aminomethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171556765) has the molecular formula C11H17F3N4O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-(aminomethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2-(aminomethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171556765 |
| Molecular Formula | C11H17F3N4O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(aminomethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | NCC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H13NO3.C5H4F3N3/c7-3-5-6(9)4(8)1-2-10-5;6-5(7,8)3-1-10-2-4(9)11-3/h4-6,8-9H,1-3,7H2;1-2H,(H2,9,11) |
| InChIKey | GMANVIUQTZQLMD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |