C18H19F3N4O7S — CID 171556799
4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylsulfamoyl]benzoic acid (PubChem CID 171556799) has the molecular formula C18H19F3N4O7S and a molecular weight of 492.43 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylsulfamoyl]benzoic acid.
| Compound Name | 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 171556799 |
| Molecular Formula | C18H19F3N4O7S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C18H19F3N4O7S/c19-18(20,21)13-6-22-7-14(25-13)24-11-8-32-12(16(27)15(11)26)5-23-33(30,31)10-3-1-9(2-4-10)17(28)29/h1-4,6-7,11-12,15-16,23,26-27H,5,8H2,(H,24,25)(H,28,29)/t11-,12+,15+,16-/m0/s1 |
| InChIKey | NEZXTLZXCWVTIV-OJDYBEQGSA-N |
| XLogP | 0.07 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |