C23H27F4N5O5 — CID 171558203
4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]-2-fluorobenzoic acid (PubChem CID 171558203) has the molecular formula C23H27F4N5O5 and a molecular weight of 529.49 g/mol. Its IUPAC name is 4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]-2-fluorobenzoic acid.
| Compound Name | 4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 171558203 |
| Molecular Formula | C23H27F4N5O5 |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCN(C[C@H]3OC[C@H](Nc4cncc(C(F)(F)F)n4)[C@@H](O)[C@H]3O)CC2)cc1F |
| InChI | InChI=1S/C23H27F4N5O5/c24-15-7-13(1-2-14(15)22(35)36)10-31-3-5-32(6-4-31)11-17-21(34)20(33)16(12-37-17)29-19-9-28-8-18(30-19)23(25,26)27/h1-2,7-9,16-17,20-21,33-34H,3-6,10-12H2,(H,29,30)(H,35,36)/t16-,17+,20+,21-/m0/s1 |
| InChIKey | YDOQZKPDQYAMEB-NLEAXPPASA-N |
| XLogP | 1.05 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |