C29H39F3N6O4 — CID 171399926
1-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethanone (PubChem CID 171399926) has the molecular formula C29H39F3N6O4 and a molecular weight of 592.66 g/mol. Its IUPAC name is 1-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 171399926 |
| Molecular Formula | C29H39F3N6O4 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 1-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCC(CN3CCN(C[C@H]4OC[C@H](Nc5cncc(C(F)(F)F)n5)[C@@H](O)[C@H]4O)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H39F3N6O4/c1-19(39)21-2-4-22(5-3-21)38-8-6-20(7-9-38)16-36-10-12-37(13-11-36)17-24-28(41)27(40)23(18-42-24)34-26-15-33-14-25(35-26)29(30,31)32/h2-5,14-15,20,23-24,27-28,40-41H,6-13,16-18H2,1H3,(H,34,35)/t23-,24+,27+,28-/m0/s1 |
| InChIKey | TVUKJXAYRDTFLR-COHKGRJRSA-N |
| XLogP | 2.13 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |