C33H45F3N6O4 — CID 167221285
cyclopentyl-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]methanone (PubChem CID 167221285) has the molecular formula C33H45F3N6O4 and a molecular weight of 646.76 g/mol. Its IUPAC name is cyclopentyl-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]methanone.
| Compound Name | cyclopentyl-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 167221285 |
| Molecular Formula | C33H45F3N6O4 |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | cyclopentyl-[4-[4-[[4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]piperazin-1-yl]methyl]piperidin-1-yl]phenyl]methanone |
| SMILES | O=C(c1ccc(N2CCC(CN3CCN(C[C@H]4OC[C@H](Nc5cncc(C(F)(F)F)n5)[C@@H](O)[C@H]4O)CC3)CC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C33H45F3N6O4/c34-33(35,36)28-17-37-18-29(39-28)38-26-21-46-27(32(45)31(26)44)20-41-15-13-40(14-16-41)19-22-9-11-42(12-10-22)25-7-5-24(6-8-25)30(43)23-3-1-2-4-23/h5-8,17-18,22-23,26-27,31-32,44-45H,1-4,9-16,19-21H2,(H,38,39)/t26-,27+,31+,32-/m0/s1 |
| InChIKey | PAWXVIPXUPTZNY-MAMCHFAYSA-N |
| XLogP | 3.30 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |