C23H31F3N4O5S — CID 171557462
4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylamino]sulfanylbenzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557462) has the molecular formula C23H31F3N4O5S and a molecular weight of 532.59 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylamino]sulfanylbenzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylamino]sulfanylbenzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557462 |
| Molecular Formula | C23H31F3N4O5S |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylamino]sulfanylbenzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC.CC1(C)OC2CCOC(CNSc3ccc(C(=O)O)cc3)C2O1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H21NO5S.C5H4F3N3.C2H6/c1-16(2)21-12-7-8-20-13(14(12)22-16)9-17-23-11-5-3-10(4-6-11)15(18)19;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h3-6,12-14,17H,7-9H2,1-2H3,(H,18,19);1-2H,(H2,9,11);1-2H3 |
| InChIKey | QKBUPYQOCQKFLW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|