C24H24F7N3O8 — CID 171556933
(2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 171556933) has the molecular formula C24H24F7N3O8 and a molecular weight of 615.46 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171556933 |
| Molecular Formula | C24H24F7N3O8 |
| Molecular Weight | 615.46 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCC(=O)Oc1c(F)c(F)cc(F)c1F)NC[C@H]1OC[C@H](Nc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H24F7N3O8/c25-11-6-12(26)20(28)23(19(11)27)42-18(36)10-40-5-4-39-9-17(35)32-7-14-22(38)21(37)13(8-41-14)33-16-3-1-2-15(34-16)24(29,30)31/h1-3,6,13-14,21-22,37-38H,4-5,7-10H2,(H,32,35)(H,33,34)/t13-,14+,21+,22-/m0/s1 |
| InChIKey | GVOALXKVKHLOEX-CCFWVRKCSA-N |
| XLogP | 1.31 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|