C23H23F7N4O8 — CID 171400059
(2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 171400059) has the molecular formula C23H23F7N4O8 and a molecular weight of 616.44 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171400059 |
| Molecular Formula | C23H23F7N4O8 |
| Molecular Weight | 616.44 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCC(=O)Oc1c(F)c(F)cc(F)c1F)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H23F7N4O8/c24-10-3-11(25)19(27)22(18(10)26)42-17(36)9-40-2-1-39-8-16(35)32-4-13-21(38)20(37)12(7-41-13)33-15-6-31-5-14(34-15)23(28,29)30/h3,5-6,12-13,20-21,37-38H,1-2,4,7-9H2,(H,32,35)(H,33,34)/t12-,13+,20+,21-/m0/s1 |
| InChIKey | QEEKXDCGQFKGIY-IYMIQRSASA-N |
| XLogP | 0.71 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|