C27H23F7N4O7 — CID 171400138
(2,3,5,6-tetrafluorophenyl) 2-[4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethyl]phenoxy]acetate (PubChem CID 171400138) has the molecular formula C27H23F7N4O7 and a molecular weight of 648.49 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 2-[4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethyl]phenoxy]acetate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 2-[4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 171400138 |
| Molecular Formula | C27H23F7N4O7 |
| Molecular Weight | 648.49 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 2-[4-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethyl]phenoxy]acetate |
| SMILES | O=C(Cc1ccc(OCC(=O)Oc2c(F)c(F)cc(F)c2F)cc1)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H23F7N4O7/c28-14-6-15(29)23(31)26(22(14)30)45-21(40)11-43-13-3-1-12(2-4-13)5-20(39)36-7-17-25(42)24(41)16(10-44-17)37-19-9-35-8-18(38-19)27(32,33)34/h1-4,6,8-9,16-17,24-25,41-42H,5,7,10-11H2,(H,36,39)(H,37,38)/t16-,17+,24+,25-/m0/s1 |
| InChIKey | CKBYQPIATQGSGM-TXUMWKRHSA-N |
| XLogP | 2.30 |
| TPSA | 152.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|