C21H23NO5 — CID 171557116
4-methyl-5-nitro-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran (PubChem CID 171557116) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-methyl-5-nitro-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran.
| Compound Name | 4-methyl-5-nitro-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 171557116 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-methyl-5-nitro-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
| SMILES | CC1C([N+](=O)[O-])=COC(COCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C21H23NO5/c1-16-19(22(23)24)14-26-20(15-25-12-17-8-4-2-5-9-17)21(16)27-13-18-10-6-3-7-11-18/h2-11,14,16,20-21H,12-13,15H2,1H3 |
| InChIKey | JVQGTTZXZONLKB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|