C11H17F3N4O2 — CID 171557179
1-methylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557179) has the molecular formula C11H17F3N4O2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 1-methylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 1-methylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557179 |
| Molecular Formula | C11H17F3N4O2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 1-methylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CN1CCC(O)C(O)C1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H13NO2.C5H4F3N3/c1-7-3-2-5(8)6(9)4-7;6-5(7,8)3-1-10-2-4(9)11-3/h5-6,8-9H,2-4H2,1H3;1-2H,(H2,9,11) |
| InChIKey | XYDMRLJWUNCITO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |