C19H25F3N2O9 — CID 171557261
2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid (PubChem CID 171557261) has the molecular formula C19H25F3N2O9 and a molecular weight of 482.41 g/mol. Its IUPAC name is 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171557261 |
| Molecular Formula | C19H25F3N2O9 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid |
| SMILES | C[C@H]1O[C@H](C(=O)NCCOCCOCC(=O)O)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H25F3N2O9/c1-10-14(27)15(28)16(33-12-4-2-3-11(24-12)19(20,21)22)17(32-10)18(29)23-5-6-30-7-8-31-9-13(25)26/h2-4,10,14-17,27-28H,5-9H2,1H3,(H,23,29)(H,25,26)/t10-,14+,15+,16-,17+/m1/s1 |
| InChIKey | HMSSFKKMIWRZJA-BDNDHPQMSA-N |
| XLogP | -0.41 |
| TPSA | 156.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|