C23H33F3N2O9 — CID 171558416
tert-butyl 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetate (PubChem CID 171558416) has the molecular formula C23H33F3N2O9 and a molecular weight of 538.52 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171558416 |
| Molecular Formula | C23H33F3N2O9 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | tert-butyl 2-[2-[2-[[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetate |
| SMILES | C[C@H]1O[C@H](C(=O)NCCOCCOCC(=O)OC(C)(C)C)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H33F3N2O9/c1-13-17(30)18(31)19(36-15-7-5-6-14(28-15)23(24,25)26)20(35-13)21(32)27-8-9-33-10-11-34-12-16(29)37-22(2,3)4/h5-7,13,17-20,30-31H,8-12H2,1-4H3,(H,27,32)/t13-,17+,18+,19-,20+/m1/s1 |
| InChIKey | YQDHTDWVESALPM-KHSUIZDFSA-N |
| XLogP | 0.85 |
| TPSA | 145.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|