C13H15F3N2O5 — CID 171558856
(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carboxamide (PubChem CID 171558856) has the molecular formula C13H15F3N2O5 and a molecular weight of 336.27 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carboxamide.
| Compound Name | (2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carboxamide |
|---|---|
| PubChem CID | 171558856 |
| Molecular Formula | C13H15F3N2O5 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (2S,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carboxamide |
| SMILES | C[C@H]1O[C@H](C(N)=O)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H15F3N2O5/c1-5-8(19)9(20)10(11(22-5)12(17)21)23-7-4-2-3-6(18-7)13(14,15)16/h2-5,8-11,19-20H,1H3,(H2,17,21)/t5-,8+,9+,10-,11+/m1/s1 |
| InChIKey | VMNRQGOPHOKJRE-JGVZAMNVSA-N |
| XLogP | -0.16 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |