C19H25F3N2O7 — CID 177015595
2-[2-[2-[[(2S,3R,6R)-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid (PubChem CID 177015595) has the molecular formula C19H25F3N2O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is 2-[2-[2-[[(2S,3R,6R)-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(2S,3R,6R)-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 177015595 |
| Molecular Formula | C19H25F3N2O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[2-[2-[[(2S,3R,6R)-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-2-carbonyl]amino]ethoxy]ethoxy]acetic acid |
| SMILES | C[C@@H]1CC[C@@H](Oc2cccc(C(F)(F)F)n2)[C@@H](C(=O)NCCOCCOCC(=O)O)O1 |
| InChI | InChI=1S/C19H25F3N2O7/c1-12-5-6-13(31-15-4-2-3-14(24-15)19(20,21)22)17(30-12)18(27)23-7-8-28-9-10-29-11-16(25)26/h2-4,12-13,17H,5-11H2,1H3,(H,23,27)(H,25,26)/t12-,13-,17+/m1/s1 |
| InChIKey | TXOPMDXLXCQVTF-XNJGSVPQSA-N |
| XLogP | 1.65 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|