C15H23F3N4O3 — CID 171557323
(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;N-methyl-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557323) has the molecular formula C15H23F3N4O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;N-methyl-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;N-methyl-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557323 |
| Molecular Formula | C15H23F3N4O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methanamine;N-methyl-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)OC2CCOC(CN)C2O1.CNc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H17NO3.C6H6F3N3/c1-9(2)12-6-3-4-11-7(5-10)8(6)13-9;1-10-5-3-11-2-4(12-5)6(7,8)9/h6-8H,3-5,10H2,1-2H3;2-3H,1H3,(H,10,12) |
| InChIKey | ZHKBQTAKWJPUMP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |