C15H22F3NO3S — CID 171557424
4-ethoxy-1-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]heptane-2,3-diol (PubChem CID 171557424) has the molecular formula C15H22F3NO3S and a molecular weight of 353.41 g/mol. Its IUPAC name is 4-ethoxy-1-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]heptane-2,3-diol.
| Compound Name | 4-ethoxy-1-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]heptane-2,3-diol |
|---|---|
| PubChem CID | 171557424 |
| Molecular Formula | C15H22F3NO3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-ethoxy-1-[[6-(trifluoromethyl)-2-pyridinyl]sulfanyl]heptane-2,3-diol |
| SMILES | CCCC(OCC)C(O)C(O)CSc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H22F3NO3S/c1-3-6-11(22-4-2)14(21)10(20)9-23-13-8-5-7-12(19-13)15(16,17)18/h5,7-8,10-11,14,20-21H,3-4,6,9H2,1-2H3 |
| InChIKey | UPRBMHVYYYBXSP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |