C13H18F3NO3S — CID 139756477
[6-methyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756477) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is [6-methyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [6-methyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756477 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [6-methyl-4-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | Cc1cc(SCCOCCOCC(F)(F)F)cc(CO)n1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-10-6-12(7-11(8-18)17-10)21-5-4-19-2-3-20-9-13(14,15)16/h6-7,18H,2-5,8-9H2,1H3 |
| InChIKey | HYOYBBOHPPKEKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|