C14H20F3NO4S — CID 139756525
[3-methyl-4-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756525) has the molecular formula C14H20F3NO4S and a molecular weight of 355.38 g/mol. Its IUPAC name is [3-methyl-4-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-methyl-4-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756525 |
| Molecular Formula | C14H20F3NO4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | [3-methyl-4-[2-[2-[2-(trifluoromethoxy)ethoxy]ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | Cc1c(SCCOCCOCCOC(F)(F)F)ccnc1CO |
| InChI | InChI=1S/C14H20F3NO4S/c1-11-12(10-19)18-3-2-13(11)23-9-8-21-5-4-20-6-7-22-14(15,16)17/h2-3,19H,4-10H2,1H3 |
| InChIKey | NPZFCUBSOMCRNJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|