C12H16F3NO3S — CID 139756513
[3-methyl-4-[2-[2-(trifluoromethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol (PubChem CID 139756513) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is [3-methyl-4-[2-[2-(trifluoromethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol.
| Compound Name | [3-methyl-4-[2-[2-(trifluoromethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 139756513 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [3-methyl-4-[2-[2-(trifluoromethoxy)ethoxy]ethylsulfanyl]-2-pyridinyl]methanol |
| SMILES | Cc1c(SCCOCCOC(F)(F)F)ccnc1CO |
| InChI | InChI=1S/C12H16F3NO3S/c1-9-10(8-17)16-3-2-11(9)20-7-6-18-4-5-19-12(13,14)15/h2-3,17H,4-8H2,1H3 |
| InChIKey | CHEYFADNHDEZMT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|