C25H30F3N3O8 — CID 171557658
benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 171557658) has the molecular formula C25H30F3N3O8 and a molecular weight of 557.52 g/mol. Its IUPAC name is benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171557658 |
| Molecular Formula | C25H30F3N3O8 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | benzyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | O=C(COCCOCC(=O)OCc1ccccc1)NC[C@H]1OC[C@H](Nc2ccnc(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H30F3N3O8/c26-25(27,28)20-10-17(6-7-29-20)31-18-13-38-19(24(35)23(18)34)11-30-21(32)14-36-8-9-37-15-22(33)39-12-16-4-2-1-3-5-16/h1-7,10,18-19,23-24,34-35H,8-9,11-15H2,(H,29,31)(H,30,32)/t18-,19+,23+,24-/m0/s1 |
| InChIKey | QSJULDYIKIAVGX-LUZMIZLMSA-N |
| XLogP | 0.89 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|