C19H26F3N3O8 — CID 177015443
methyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 177015443) has the molecular formula C19H26F3N3O8 and a molecular weight of 481.42 g/mol. Its IUPAC name is methyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | methyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 177015443 |
| Molecular Formula | C19H26F3N3O8 |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | methyl 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | COC(=O)COCCOCC(=O)NC[C@H]1OC[C@H](Nc2ccnc(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H26F3N3O8/c1-30-16(27)10-32-5-4-31-9-15(26)24-7-13-18(29)17(28)12(8-33-13)25-11-2-3-23-14(6-11)19(20,21)22/h2-3,6,12-13,17-18,28-29H,4-5,7-10H2,1H3,(H,23,25)(H,24,26)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | XAWSLEUUEYXHCM-DECQCQTCSA-N |
| XLogP | -0.68 |
| TPSA | 148.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|