C18H24F3N3O8 — CID 171556558
2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 171556558) has the molecular formula C18H24F3N3O8 and a molecular weight of 467.40 g/mol. Its IUPAC name is 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171556558 |
| Molecular Formula | C18H24F3N3O8 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[2-(trifluoromethyl)-4-pyridinyl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCC(=O)NC[C@H]1OC[C@H](Nc2ccnc(C(F)(F)F)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H24F3N3O8/c19-18(20,21)13-5-10(1-2-22-13)24-11-7-32-12(17(29)16(11)28)6-23-14(25)8-30-3-4-31-9-15(26)27/h1-2,5,11-12,16-17,28-29H,3-4,6-9H2,(H,22,24)(H,23,25)(H,26,27)/t11-,12+,16+,17-/m0/s1 |
| InChIKey | ZCJRRIPNWXVKEA-SONRMIBWSA-N |
| XLogP | -0.76 |
| TPSA | 159.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|