C18H18F3NO5S — CID 171557807
(2S,3R,4S,5S)-5-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-2-yl]oxy-2-(phenylsulfanylmethyl)oxane-3,4-diol (PubChem CID 171557807) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-2-yl]oxy-2-(phenylsulfanylmethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-5-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-2-yl]oxy-2-(phenylsulfanylmethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 171557807 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (2S,3R,4S,5S)-5-[1-oxido-6-(trifluoromethyl)pyridin-1-ium-2-yl]oxy-2-(phenylsulfanylmethyl)oxane-3,4-diol |
| SMILES | [O-][n+]1c(O[C@H]2CO[C@H](CSc3ccccc3)[C@H](O)[C@@H]2O)cccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO5S/c19-18(20,21)14-7-4-8-15(22(14)25)27-12-9-26-13(17(24)16(12)23)10-28-11-5-2-1-3-6-11/h1-8,12-13,16-17,23-24H,9-10H2/t12-,13+,16+,17-/m0/s1 |
| InChIKey | GSCZHJCFDRPDCH-IXKJSCDLSA-N |
| XLogP | 2.00 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|