C23H24F3N3O5 — CID 171557967
oxane-3,4-diol;4-phenylbenzoic acid;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557967) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is oxane-3,4-diol;4-phenylbenzoic acid;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | oxane-3,4-diol;4-phenylbenzoic acid;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557967 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | oxane-3,4-diol;4-phenylbenzoic acid;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Nc1cncc(C(F)(F)F)n1.O=C(O)c1ccc(-c2ccccc2)cc1.OC1CCOCC1O |
| InChI | InChI=1S/C13H10O2.C5H4F3N3.C5H10O3/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;6-5(7,8)3-1-10-2-4(9)11-3;6-4-1-2-8-3-5(4)7/h1-9H,(H,14,15);1-2H,(H2,9,11);4-7H,1-3H2 |
| InChIKey | QMBVVXMIMYJIPD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |