C19H20F3N3O5 — CID 171556974
3-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]propanoic acid (PubChem CID 171556974) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is 3-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 171556974 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3-[4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc([C@H]2OC[C@H](O)[C@H](O)[C@H]2Nc2cncc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H20F3N3O5/c20-19(21,22)13-7-23-8-14(24-13)25-16-17(29)12(26)9-30-18(16)11-4-1-10(2-5-11)3-6-15(27)28/h1-2,4-5,7-8,12,16-18,26,29H,3,6,9H2,(H,24,25)(H,27,28)/t12-,16+,17-,18+/m0/s1 |
| InChIKey | JKYOLVKFZNXTHF-PSMGESJCSA-N |
| XLogP | 1.79 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |