C23H27F3LiN3O5-2 — CID 171556560
lithium;benzyl 6-oxohexanoate;(2S,3R,4S)-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]pentane-2,3-diol (PubChem CID 171556560) has the molecular formula C23H27F3LiN3O5-2 and a molecular weight of 489.42 g/mol. Its IUPAC name is lithium;benzyl 6-oxohexanoate;(2S,3R,4S)-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]pentane-2,3-diol.
| Compound Name | lithium;benzyl 6-oxohexanoate;(2S,3R,4S)-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]pentane-2,3-diol |
|---|---|
| PubChem CID | 171556560 |
| Molecular Formula | C23H27F3LiN3O5-2 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | lithium;benzyl 6-oxohexanoate;(2S,3R,4S)-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]pentane-2,3-diol |
| SMILES | O=[C-]CCCCC(=O)OCc1ccccc1.[CH2-][C@H](O)[C@H](O)[C@H]([CH2-])Nc1cncc(C(F)(F)F)n1.[Li+] |
| InChI | InChI=1S/C13H15O3.C10H12F3N3O2.Li/c14-10-6-2-5-9-13(15)16-11-12-7-3-1-4-8-12;1-5(9(18)6(2)17)15-8-4-14-3-7(16-8)10(11,12)13;/h1,3-4,7-8H,2,5-6,9,11H2;3-6,9,17-18H,1-2H2,(H,15,16);/q-1;-2;+1/t;5-,6-,9+;/m.0./s1 |
| InChIKey | PEPXWQZUEWKQHW-VCIOMHECSA-N |
| XLogP | 0.07 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|