C17H18F3N3O3 — CID 171556903
(3S,4R,5R,6R)-6-benzyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556903) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-benzyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-6-benzyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556903 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (3S,4R,5R,6R)-6-benzyl-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cncc(C(F)(F)F)n2)[C@@H](Cc2ccccc2)OC[C@@H]1O |
| InChI | InChI=1S/C17H18F3N3O3/c18-17(19,20)13-7-21-8-14(22-13)23-15-12(26-9-11(24)16(15)25)6-10-4-2-1-3-5-10/h1-5,7-8,11-12,15-16,24-25H,6,9H2,(H,22,23)/t11-,12+,15-,16-/m0/s1 |
| InChIKey | LLTWREIXLQVMAO-VZAMPYOESA-N |
| XLogP | 1.64 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |