C19H21NO3 — CID 171558301
(4-benzylphenyl)-(3,4-dihydroxypiperidin-1-yl)methanone (PubChem CID 171558301) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (4-benzylphenyl)-(3,4-dihydroxypiperidin-1-yl)methanone.
| Compound Name | (4-benzylphenyl)-(3,4-dihydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 171558301 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (4-benzylphenyl)-(3,4-dihydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(Cc2ccccc2)cc1)N1CCC(O)C(O)C1 |
| InChI | InChI=1S/C19H21NO3/c21-17-10-11-20(13-18(17)22)19(23)16-8-6-15(7-9-16)12-14-4-2-1-3-5-14/h1-9,17-18,21-22H,10-13H2 |
| InChIKey | XNUHUHUHPUBJSJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |