C18H20F2N2O4S — CID 171558310
(2S,3R,4S,5S)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-2-(pyridin-2-ylsulfanylmethyl)oxane-3,4-diol (PubChem CID 171558310) has the molecular formula C18H20F2N2O4S and a molecular weight of 398.43 g/mol. Its IUPAC name is (2S,3R,4S,5S)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-2-(pyridin-2-ylsulfanylmethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-2-(pyridin-2-ylsulfanylmethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 171558310 |
| Molecular Formula | C18H20F2N2O4S |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2S,3R,4S,5S)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-2-(pyridin-2-ylsulfanylmethyl)oxane-3,4-diol |
| SMILES | CC(F)(F)c1cccc(O[C@H]2CO[C@H](CSc3ccccn3)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C18H20F2N2O4S/c1-18(19,20)13-5-4-6-14(22-13)26-11-9-25-12(17(24)16(11)23)10-27-15-7-2-3-8-21-15/h2-8,11-12,16-17,23-24H,9-10H2,1H3/t11-,12+,16+,17-/m0/s1 |
| InChIKey | OUUAFYOULXHOCD-SONRMIBWSA-N |
| XLogP | 2.25 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |