C20H23F6N7O4 — CID 171558311
(2R,3R,4R,5S)-2-[[5-[3-(trifluoromethyl)piperazin-1-yl]pyrazin-2-yl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171558311) has the molecular formula C20H23F6N7O4 and a molecular weight of 539.44 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[5-[3-(trifluoromethyl)piperazin-1-yl]pyrazin-2-yl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[[5-[3-(trifluoromethyl)piperazin-1-yl]pyrazin-2-yl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171558311 |
| Molecular Formula | C20H23F6N7O4 |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[5-[3-(trifluoromethyl)piperazin-1-yl]pyrazin-2-yl]oxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CO[C@@H]1COc1cnc(N2CCNC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C20H23F6N7O4/c21-19(22,23)12-3-27-4-14(32-12)31-10-8-36-11(18(35)17(10)34)9-37-16-6-29-15(5-30-16)33-2-1-28-13(7-33)20(24,25)26/h3-6,10-11,13,17-18,28,34-35H,1-2,7-9H2,(H,31,32)/t10-,11+,13?,17+,18-/m0/s1 |
| InChIKey | KZHCEULGSJIXNV-JPAWRJKISA-N |
| XLogP | 0.61 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |