C12H15F4N3O3 — CID 171558605
(1R,2S,3R,4S,6S)-4-fluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol (PubChem CID 171558605) has the molecular formula C12H15F4N3O3 and a molecular weight of 325.26 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S)-4-fluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R,4S,6S)-4-fluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 171558605 |
| Molecular Formula | C12H15F4N3O3 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (1R,2S,3R,4S,6S)-4-fluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)C[C@@H]1F |
| InChI | InChI=1S/C12H15F4N3O3/c13-6-1-7(11(22)10(21)5(6)4-20)18-9-3-17-2-8(19-9)12(14,15)16/h2-3,5-7,10-11,20-22H,1,4H2,(H,18,19)/t5-,6-,7-,10-,11+/m0/s1 |
| InChIKey | ZFKWMQSMSUFSLP-UMVHFSBVSA-N |
| XLogP | 0.35 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |