C12H14F5N3O3 — CID 171558848
(1R,2S,3R,6S)-4,4-difluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol (PubChem CID 171558848) has the molecular formula C12H14F5N3O3 and a molecular weight of 343.25 g/mol. Its IUPAC name is (1R,2S,3R,6S)-4,4-difluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R,6S)-4,4-difluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 171558848 |
| Molecular Formula | C12H14F5N3O3 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (1R,2S,3R,6S)-4,4-difluoro-3-(hydroxymethyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
| SMILES | OC[C@@H]1[C@H](O)[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CC1(F)F |
| InChI | InChI=1S/C12H14F5N3O3/c13-11(14)1-6(10(23)9(22)5(11)4-21)19-8-3-18-2-7(20-8)12(15,16)17/h2-3,5-6,9-10,21-23H,1,4H2,(H,19,20)/t5-,6+,9+,10-/m1/s1 |
| InChIKey | IJSAQWIIAVYDDH-OFLNYADTSA-N |
| XLogP | 0.65 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |