C14H18F5N3O2 — CID 178007711
(1R,2S,3R,6S)-4,4-difluoro-3-propyl-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol (PubChem CID 178007711) has the molecular formula C14H18F5N3O2 and a molecular weight of 355.31 g/mol. Its IUPAC name is (1R,2S,3R,6S)-4,4-difluoro-3-propyl-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R,6S)-4,4-difluoro-3-propyl-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 178007711 |
| Molecular Formula | C14H18F5N3O2 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (1R,2S,3R,6S)-4,4-difluoro-3-propyl-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
| SMILES | CCC[C@@H]1[C@H](O)[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CC1(F)F |
| InChI | InChI=1S/C14H18F5N3O2/c1-2-3-7-11(23)12(24)8(4-13(7,15)16)21-10-6-20-5-9(22-10)14(17,18)19/h5-8,11-12,23-24H,2-4H2,1H3,(H,21,22)/t7-,8+,11+,12-/m1/s1 |
| InChIKey | LGUSIGNNKBZTRP-UFGYURQFSA-N |
| XLogP | 2.45 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |