C27H28F3N3O4 — CID 171558675
(3'S,4'R,5'R)-5-[(4-propan-2-ylphenyl)methyl]-5'-[[6-(trifluoromethyl)pyrazin-2-yl]amino]spiro[3H-1-benzofuran-2,6'-oxane]-3',4'-diol (PubChem CID 171558675) has the molecular formula C27H28F3N3O4 and a molecular weight of 515.53 g/mol. Its IUPAC name is (3'S,4'R,5'R)-5-[(4-propan-2-ylphenyl)methyl]-5'-[[6-(trifluoromethyl)pyrazin-2-yl]amino]spiro[3H-1-benzofuran-2,6'-oxane]-3',4'-diol.
| Compound Name | (3'S,4'R,5'R)-5-[(4-propan-2-ylphenyl)methyl]-5'-[[6-(trifluoromethyl)pyrazin-2-yl]amino]spiro[3H-1-benzofuran-2,6'-oxane]-3',4'-diol |
|---|---|
| PubChem CID | 171558675 |
| Molecular Formula | C27H28F3N3O4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | (3'S,4'R,5'R)-5-[(4-propan-2-ylphenyl)methyl]-5'-[[6-(trifluoromethyl)pyrazin-2-yl]amino]spiro[3H-1-benzofuran-2,6'-oxane]-3',4'-diol |
| SMILES | CC(C)c1ccc(Cc2ccc3c(c2)CC2(OC[C@H](O)[C@H](O)[C@H]2Nc2cncc(C(F)(F)F)n2)O3)cc1 |
| InChI | InChI=1S/C27H28F3N3O4/c1-15(2)18-6-3-16(4-7-18)9-17-5-8-21-19(10-17)11-26(37-21)25(24(35)20(34)14-36-26)33-23-13-31-12-22(32-23)27(28,29)30/h3-8,10,12-13,15,20,24-25,34-35H,9,11,14H2,1-2H3,(H,32,33)/t20-,24-,25+,26?/m0/s1 |
| InChIKey | MIZRADVGLKJWOY-CGNAOQOPSA-N |
| XLogP | 4.07 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |