C28H32F3N3O4 — CID 178008296
(2S,3R,4R)-4-[2-methyl-5-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-2-yl]-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]butane-1,2,3-triol (PubChem CID 178008296) has the molecular formula C28H32F3N3O4 and a molecular weight of 531.58 g/mol. Its IUPAC name is (2S,3R,4R)-4-[2-methyl-5-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-2-yl]-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]butane-1,2,3-triol.
| Compound Name | (2S,3R,4R)-4-[2-methyl-5-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-2-yl]-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]butane-1,2,3-triol |
|---|---|
| PubChem CID | 178008296 |
| Molecular Formula | C28H32F3N3O4 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (2S,3R,4R)-4-[2-methyl-5-[(4-propan-2-ylphenyl)methyl]-3H-1-benzofuran-2-yl]-4-[[6-(trifluoromethyl)pyrazin-2-yl]amino]butane-1,2,3-triol |
| SMILES | CC(C)c1ccc(Cc2ccc3c(c2)CC(C)([C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@@H](O)CO)O3)cc1 |
| InChI | InChI=1S/C28H32F3N3O4/c1-16(2)19-7-4-17(5-8-19)10-18-6-9-22-20(11-18)12-27(3,38-22)26(25(37)21(36)15-35)34-24-14-32-13-23(33-24)28(29,30)31/h4-9,11,13-14,16,21,25-26,35-37H,10,12,15H2,1-3H3,(H,33,34)/t21-,25-,26+,27?/m0/s1 |
| InChIKey | PDGKSWOLCITPKB-ZBNCUDNBSA-N |
| XLogP | 4.10 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |