C22H34F3N5O6 — CID 171558743
methyl 6-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558743) has the molecular formula C22H34F3N5O6 and a molecular weight of 521.54 g/mol. Its IUPAC name is methyl 6-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | methyl 6-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558743 |
| Molecular Formula | C22H34F3N5O6 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | methyl 6-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoylamino]hexanoate;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | COC(=O)CCCCCNC(=O)NCC1OCCC2OC(C)(C)OC12.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H30N2O6.C5H4F3N3/c1-17(2)24-12-8-10-23-13(15(12)25-17)11-19-16(21)18-9-6-4-5-7-14(20)22-3;6-5(7,8)3-1-10-2-4(9)11-3/h12-13,15H,4-11H2,1-3H3,(H2,18,19,21);1-2H,(H2,9,11) |
| InChIKey | GMILRPLZTCYIJB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|