C11H16F3N3O3 — CID 171558763
2-methyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171558763) has the molecular formula C11H16F3N3O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 2-methyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 2-methyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171558763 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-methyloxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1OCCC(O)C1O.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H12O3.C5H4F3N3/c1-4-6(8)5(7)2-3-9-4;6-5(7,8)3-1-10-2-4(9)11-3/h4-8H,2-3H2,1H3;1-2H,(H2,9,11) |
| InChIKey | VNXJEYIVIJTSLF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |