C17H18F3IN4O3 — CID 171558766
(3S,4R,5R,6R)-6-[4-[(iodoamino)methyl]phenyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171558766) has the molecular formula C17H18F3IN4O3 and a molecular weight of 510.25 g/mol. Its IUPAC name is (3S,4R,5R,6R)-6-[4-[(iodoamino)methyl]phenyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (3S,4R,5R,6R)-6-[4-[(iodoamino)methyl]phenyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171558766 |
| Molecular Formula | C17H18F3IN4O3 |
| Molecular Weight | 510.25 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | (3S,4R,5R,6R)-6-[4-[(iodoamino)methyl]phenyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cncc(C(F)(F)F)n2)[C@@H](c2ccc(CNI)cc2)OC[C@@H]1O |
| InChI | InChI=1S/C17H18F3IN4O3/c18-17(19,20)12-6-22-7-13(24-12)25-14-15(27)11(26)8-28-16(14)10-3-1-9(2-4-10)5-23-21/h1-4,6-7,11,14-16,23,26-27H,5,8H2,(H,24,25)/t11-,14+,15-,16+/m0/s1 |
| InChIKey | SSCKPXUCCCEOGE-BJKJVOPESA-N |
| XLogP | 2.21 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|