C14H23ClN2O — CID 171560544
5-chloro-3-[(4S)-3,4-dimethylpiperidin-4-yl]-1H-pyridin-2-one;ethane (PubChem CID 171560544) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 5-chloro-3-[(4S)-3,4-dimethylpiperidin-4-yl]-1H-pyridin-2-one;ethane.
| Compound Name | 5-chloro-3-[(4S)-3,4-dimethylpiperidin-4-yl]-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 171560544 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-chloro-3-[(4S)-3,4-dimethylpiperidin-4-yl]-1H-pyridin-2-one;ethane |
| SMILES | CC.CC1CNCC[C@]1(C)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C12H17ClN2O.C2H6/c1-8-6-14-4-3-12(8,2)10-5-9(13)7-15-11(10)16;1-2/h5,7-8,14H,3-4,6H2,1-2H3,(H,15,16);1-2H3/t8?,12-;/m0./s1 |
| InChIKey | QQCXPAQJLIBECS-COSMAPIXSA-N |
| XLogP | 2.94 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |