C31H37N7O2 — CID 171563137
N-[2-[[4-[2-(2-amino-3-pyridinyl)-5-(3,6-dihydro-2H-pyran-4-yl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl-but-3-enylamino]ethyl]formamide;methane (PubChem CID 171563137) has the molecular formula C31H37N7O2 and a molecular weight of 539.68 g/mol. Its IUPAC name is N-[2-[[4-[2-(2-amino-3-pyridinyl)-5-(3,6-dihydro-2H-pyran-4-yl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl-but-3-enylamino]ethyl]formamide;methane.
| Compound Name | N-[2-[[4-[2-(2-amino-3-pyridinyl)-5-(3,6-dihydro-2H-pyran-4-yl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl-but-3-enylamino]ethyl]formamide;methane |
|---|---|
| PubChem CID | 171563137 |
| Molecular Formula | C31H37N7O2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | N-[2-[[4-[2-(2-amino-3-pyridinyl)-5-(3,6-dihydro-2H-pyran-4-yl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl-but-3-enylamino]ethyl]formamide;methane |
| SMILES | C.C=CCCN(CCNC=O)Cc1ccc(-n2c(-c3cccnc3N)nc3ccc(C4=CCOCC4)nc32)cc1 |
| InChI | InChI=1S/C30H33N7O2.CH4/c1-2-3-16-36(17-15-32-21-38)20-22-6-8-24(9-7-22)37-29(25-5-4-14-33-28(25)31)35-27-11-10-26(34-30(27)37)23-12-18-39-19-13-23;/h2,4-12,14,21H,1,3,13,15-20H2,(H2,31,33)(H,32,38);1H4 |
| InChIKey | UJBUYGSYOCIWKU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|