C47H93NO6 — CID 171564186
6-[[5-(6-butyldodecanoyloxymethyl)-2,6-dihydroxyoctyl]amino]hexyl 6-butyldodecanoate (PubChem CID 171564186) has the molecular formula C47H93NO6 and a molecular weight of 768.26 g/mol. Its IUPAC name is 6-[[5-(6-butyldodecanoyloxymethyl)-2,6-dihydroxyoctyl]amino]hexyl 6-butyldodecanoate.
| Compound Name | 6-[[5-(6-butyldodecanoyloxymethyl)-2,6-dihydroxyoctyl]amino]hexyl 6-butyldodecanoate |
|---|---|
| PubChem CID | 171564186 |
| Molecular Formula | C47H93NO6 |
| Molecular Weight | 768.26 g/mol |
| Exact Mass | 767.70 |
| IUPAC Name | 6-[[5-(6-butyldodecanoyloxymethyl)-2,6-dihydroxyoctyl]amino]hexyl 6-butyldodecanoate |
| SMILES | CCCCCCC(CCCC)CCCCC(=O)OCCCCCCNCC(O)CCC(COC(=O)CCCCC(CCCC)CCCCCC)C(O)CC |
| InChI | InChI=1S/C47H93NO6/c1-6-11-15-19-29-41(27-13-8-3)31-21-23-33-46(51)53-38-26-18-17-25-37-48-39-44(49)36-35-43(45(50)10-5)40-54-47(52)34-24-22-32-42(28-14-9-4)30-20-16-12-7-2/h41-45,48-50H,6-40H2,1-5H3 |
| InChIKey | XIEAFNIJCWLWLH-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.26 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|