C17H14BrClN2O3 — CID 171568680
methyl 4-[2-(2-bromoethoxy)-5-chlorophenyl]pyrrolo[1,2-b]pyridazine-7-carboxylate (PubChem CID 171568680) has the molecular formula C17H14BrClN2O3 and a molecular weight of 409.67 g/mol. Its IUPAC name is methyl 4-[2-(2-bromoethoxy)-5-chlorophenyl]pyrrolo[1,2-b]pyridazine-7-carboxylate.
| Compound Name | methyl 4-[2-(2-bromoethoxy)-5-chlorophenyl]pyrrolo[1,2-b]pyridazine-7-carboxylate |
|---|---|
| PubChem CID | 171568680 |
| Molecular Formula | C17H14BrClN2O3 |
| Molecular Weight | 409.67 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | methyl 4-[2-(2-bromoethoxy)-5-chlorophenyl]pyrrolo[1,2-b]pyridazine-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3cc(Cl)ccc3OCCBr)ccnn12 |
| InChI | InChI=1S/C17H14BrClN2O3/c1-23-17(22)15-4-3-14-12(6-8-20-21(14)15)13-10-11(19)2-5-16(13)24-9-7-18/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | YOXMGPUEJSRECH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|