About ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide
ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide (PubChem CID 171573464) has the molecular formula C19H21BrN2O2
and a molecular weight of 389.29 g/mol. Its IUPAC name is ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide.
Molecular Properties
| Compound Name | ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide |
| PubChem CID | 171573464 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide |
| SMILES | CCOC(=O)Cc1ccc[n+](CCc2c[nH]c3ccccc23)c1.[Br-] |
| InChI | InChI=1S/C19H21N2O2.BrH/c1-2-23-19(22)12-15-6-5-10-21(14-15)11-9-16-13-20-18-8-4-3-7-17(16)18;/h3-8,10,13-14,20H,2,9,11-12H2,1H3;1H/q+1;/p-1 |
| InChIKey | FSJBJIQBXJPHHU-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide?
The IUPAC name of ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide (CID 171573464) is ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide.
What is the SMILES notation for ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide?
The canonical SMILES for ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide is CCOC(=O)Cc1ccc[n+](CCc2c[nH]c3ccccc23)c1.[Br-].
What is the InChIKey of ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide?
The InChIKey is FSJBJIQBXJPHHU-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H21N2O2.BrH/c1-2-23-19(22)12-15-6-5-10-21(14-15)11-9-16-13-20-18-8-4-3-7-17(16)18;/h3-8,10,13-14,20H,2,9,11-12H2,1H3;1H/q+1;/p-1.
What are the key properties of ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide?
ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide has a molecular weight of 389.29 g/mol, XLogP of -0.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-[2-(1H-indol-3-yl)ethyl]pyridin-1-ium-3-yl]acetate bromide is sourced from PubChem (CID 171573464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).