C11H19N3O — CID 171574183
1-(5-tert-butyl-2-cyclopropyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 171574183) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-cyclopropyl-1,2,4-triazol-3-yl)ethanol.
| Compound Name | 1-(5-tert-butyl-2-cyclopropyl-1,2,4-triazol-3-yl)ethanol |
|---|---|
| PubChem CID | 171574183 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(5-tert-butyl-2-cyclopropyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | CC(O)c1nc(C(C)(C)C)nn1C1CC1 |
| InChI | InChI=1S/C11H19N3O/c1-7(15)9-12-10(11(2,3)4)13-14(9)8-5-6-8/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | VXANAPGLWQKCRC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |