About 1-propan-2-yloxyethyl 2-acetyloxypropanoate
1-propan-2-yloxyethyl 2-acetyloxypropanoate (PubChem CID 171574286) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-propan-2-yloxyethyl 2-acetyloxypropanoate.
Molecular Properties
| Compound Name | 1-propan-2-yloxyethyl 2-acetyloxypropanoate |
| PubChem CID | 171574286 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-propan-2-yloxyethyl 2-acetyloxypropanoate |
| SMILES | CC(=O)OC(C)C(=O)OC(C)OC(C)C |
| InChI | InChI=1S/C10H18O5/c1-6(2)13-9(5)15-10(12)7(3)14-8(4)11/h6-7,9H,1-5H3 |
| InChIKey | KHPSFQBMIRHFCS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxyethyl 2-acetyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxyethyl 2-acetyloxypropanoate?
The IUPAC name of 1-propan-2-yloxyethyl 2-acetyloxypropanoate (CID 171574286) is 1-propan-2-yloxyethyl 2-acetyloxypropanoate.
What is the SMILES notation for 1-propan-2-yloxyethyl 2-acetyloxypropanoate?
The canonical SMILES for 1-propan-2-yloxyethyl 2-acetyloxypropanoate is CC(=O)OC(C)C(=O)OC(C)OC(C)C.
What is the InChIKey of 1-propan-2-yloxyethyl 2-acetyloxypropanoate?
The InChIKey is KHPSFQBMIRHFCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-6(2)13-9(5)15-10(12)7(3)14-8(4)11/h6-7,9H,1-5H3.
What are the key properties of 1-propan-2-yloxyethyl 2-acetyloxypropanoate?
1-propan-2-yloxyethyl 2-acetyloxypropanoate has a molecular weight of 218.25 g/mol, XLogP of 1.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxyethyl 2-acetyloxypropanoate is sourced from PubChem (CID 171574286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).